C26H38O5 — CID 164625494
(2E,5E,9E)-2-[(3R)-3-hydroxy-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]propylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal (PubChem CID 164625494) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (2E,5E,9E)-2-[(3R)-3-hydroxy-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]propylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal.
| Compound Name | (2E,5E,9E)-2-[(3R)-3-hydroxy-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]propylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal |
|---|---|
| PubChem CID | 164625494 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (2E,5E,9E)-2-[(3R)-3-hydroxy-3-[(2R)-2-methoxy-5-oxo-2H-furan-3-yl]propylidene]-6,10,14-trimethylpentadeca-5,9,13-trienal |
| SMILES | CO[C@@H]1OC(=O)C=C1[C@H](O)C/C=C(/C=O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H38O5/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(18-27)15-16-24(28)23-17-25(29)31-26(23)30-5/h9,11,13,15,17-18,24,26,28H,6-8,10,12,14,16H2,1-5H3/b20-11+,21-13+,22-15+/t24-,26-/m1/s1 |
| InChIKey | YYXXCKGWMYRSCV-MZIOSPBBSA-N |
| XLogP | 5.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|