C26H39N3O2 — CID 164625539
(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 164625539) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 164625539 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-N-(3-imidazol-1-ylpropyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C26H39N3O2/c1-25-10-8-19(30)16-18(25)4-5-20-21-6-7-23(26(21,2)11-9-22(20)25)24(31)28-12-3-14-29-15-13-27-17-29/h4,13,15,17,19-23,30H,3,5-12,14,16H2,1-2H3,(H,28,31)/t19-,20-,21-,22-,23+,25-,26-/m0/s1 |
| InChIKey | AWCUWLUMVOBZKH-AMKJHPCNSA-N |
| XLogP | 4.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|