About N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine
N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine (PubChem CID 164625540) has the molecular formula C15H23NO
and a molecular weight of 233.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine |
| PubChem CID | 164625540 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine |
| SMILES | CN(C)CC[C@@H]1CCC[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H23NO/c1-16(2)12-11-14-9-6-10-15(17-14)13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | ULKYOIBWCPDIQY-LSDHHAIUSA-N |
| XLogP | 3.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
The IUPAC name of N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine (CID 164625540) is N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine.
What is the SMILES notation for N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
The canonical SMILES for N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine is CN(C)CC[C@@H]1CCC[C@H](c2ccccc2)O1.
What is the InChIKey of N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
The InChIKey is ULKYOIBWCPDIQY-LSDHHAIUSA-N. The full InChI is InChI=1S/C15H23NO/c1-16(2)12-11-14-9-6-10-15(17-14)13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3/t14-,15+/m0/s1.
What are the key properties of N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine has a molecular weight of 233.36 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine is sourced from PubChem (CID 164625540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).