C26H24N2O6 — CID 164625554
17-methoxy-16-[(4-nitrophenyl)methoxy]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene (PubChem CID 164625554) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 17-methoxy-16-[(4-nitrophenyl)methoxy]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene.
| Compound Name | 17-methoxy-16-[(4-nitrophenyl)methoxy]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
|---|---|
| PubChem CID | 164625554 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 17-methoxy-16-[(4-nitrophenyl)methoxy]-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
| SMILES | COc1ccc2c(c1OCc1ccc([N+](=O)[O-])cc1)CN1CCc3cc4c(cc3C1C2)OCO4 |
| InChI | InChI=1S/C26H24N2O6/c1-31-23-7-4-17-10-22-20-12-25-24(33-15-34-25)11-18(20)8-9-27(22)13-21(17)26(23)32-14-16-2-5-19(6-3-16)28(29)30/h2-7,11-12,22H,8-10,13-15H2,1H3 |
| InChIKey | RHHOVNNOHOBTCP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|