C22H26O4 — CID 164625613
(1S,6S,12S,16S)-10-[(1E,3Z,5E)-hepta-1,3,5-trienyl]-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-diene-8,15-dione (PubChem CID 164625613) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1S,6S,12S,16S)-10-[(1E,3Z,5E)-hepta-1,3,5-trienyl]-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-diene-8,15-dione.
| Compound Name | (1S,6S,12S,16S)-10-[(1E,3Z,5E)-hepta-1,3,5-trienyl]-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-diene-8,15-dione |
|---|---|
| PubChem CID | 164625613 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (1S,6S,12S,16S)-10-[(1E,3Z,5E)-hepta-1,3,5-trienyl]-6-methyl-7,11-dioxatricyclo[7.6.1.012,16]hexadeca-9,13-diene-8,15-dione |
| SMILES | C/C=C/C=C\C=C\C1=C2C(=O)O[C@@H](C)CCCC[C@@H]3C(=O)C=C[C@H](O1)[C@H]23 |
| InChI | InChI=1S/C22H26O4/c1-3-4-5-6-7-12-18-21-20-16(17(23)13-14-19(20)26-18)11-9-8-10-15(2)25-22(21)24/h3-7,12-16,19-20H,8-11H2,1-2H3/b4-3+,6-5-,12-7+/t15-,16+,19-,20+/m0/s1 |
| InChIKey | WYNXSZIYQZELTK-JEAYVQBZSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|