About piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride
piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride (PubChem CID 164625948) has the molecular formula C18H26ClN3O2
and a molecular weight of 351.88 g/mol. Its IUPAC name is piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride |
| PubChem CID | 164625948 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride |
| SMILES | Cl.Cn1cc(C[C@@H](N)C(=O)OCC2CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C18H25N3O2.ClH/c1-21-11-14(15-4-2-3-5-17(15)21)10-16(19)18(22)23-12-13-6-8-20-9-7-13;/h2-5,11,13,16,20H,6-10,12,19H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | RBDFYPNXBLZDLJ-PKLMIRHRSA-N |
| XLogP | 2.01 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
The IUPAC name of piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride (CID 164625948) is piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride.
What is the SMILES notation for piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
The canonical SMILES for piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride is Cl.Cn1cc(C[C@@H](N)C(=O)OCC2CCNCC2)c2ccccc21.
What is the InChIKey of piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
The InChIKey is RBDFYPNXBLZDLJ-PKLMIRHRSA-N. The full InChI is InChI=1S/C18H25N3O2.ClH/c1-21-11-14(15-4-2-3-5-17(15)21)10-16(19)18(22)23-12-13-6-8-20-9-7-13;/h2-5,11,13,16,20H,6-10,12,19H2,1H3;1H/t16-;/m1./s1.
What are the key properties of piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride?
piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride has a molecular weight of 351.88 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl (2R)-2-amino-3-(1-methylindol-3-yl)propanoate;hydrochloride is sourced from PubChem (CID 164625948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).