C22H27N3O4 — CID 164625988
[(S)-[5-carbamoyl-4-oxo-1-(2-piperidin-1-ylethyl)-2-pyridinyl]-phenylmethyl] acetate (PubChem CID 164625988) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is [(S)-[5-carbamoyl-4-oxo-1-(2-piperidin-1-ylethyl)-2-pyridinyl]-phenylmethyl] acetate.
| Compound Name | [(S)-[5-carbamoyl-4-oxo-1-(2-piperidin-1-ylethyl)-2-pyridinyl]-phenylmethyl] acetate |
|---|---|
| PubChem CID | 164625988 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [(S)-[5-carbamoyl-4-oxo-1-(2-piperidin-1-ylethyl)-2-pyridinyl]-phenylmethyl] acetate |
| SMILES | CC(=O)O[C@@H](c1ccccc1)c1cc(=O)c(C(N)=O)cn1CCN1CCCCC1 |
| InChI | InChI=1S/C22H27N3O4/c1-16(26)29-21(17-8-4-2-5-9-17)19-14-20(27)18(22(23)28)15-25(19)13-12-24-10-6-3-7-11-24/h2,4-5,8-9,14-15,21H,3,6-7,10-13H2,1H3,(H2,23,28)/t21-/m0/s1 |
| InChIKey | AXZBRNWJTMYIBI-NRFANRHFSA-N |
| XLogP | 2.09 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |