C19H13Cl2N5O — CID 164626056
1-(2,6-dichloro-4-pyridinyl)-3-(6-phenylpyrazolo[1,5-a]pyridin-2-yl)urea (PubChem CID 164626056) has the molecular formula C19H13Cl2N5O and a molecular weight of 398.25 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-(6-phenylpyrazolo[1,5-a]pyridin-2-yl)urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-(6-phenylpyrazolo[1,5-a]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 164626056 |
| Molecular Formula | C19H13Cl2N5O |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-(6-phenylpyrazolo[1,5-a]pyridin-2-yl)urea |
| SMILES | O=C(Nc1cc(Cl)nc(Cl)c1)Nc1cc2ccc(-c3ccccc3)cn2n1 |
| InChI | InChI=1S/C19H13Cl2N5O/c20-16-8-14(9-17(21)23-16)22-19(27)24-18-10-15-7-6-13(11-26(15)25-18)12-4-2-1-3-5-12/h1-11H,(H2,22,23,24,25,27) |
| InChIKey | NOJKAQPFNOTJLL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|