C19H24Br2O6 — CID 164626060
[(4S)-4-[(3aS,4S,7S,7aS)-4-acetyloxy-7-bromo-6-(bromomethyl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate (PubChem CID 164626060) has the molecular formula C19H24Br2O6 and a molecular weight of 508.20 g/mol. Its IUPAC name is [(4S)-4-[(3aS,4S,7S,7aS)-4-acetyloxy-7-bromo-6-(bromomethyl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(3aS,4S,7S,7aS)-4-acetyloxy-7-bromo-6-(bromomethyl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164626060 |
| Molecular Formula | C19H24Br2O6 |
| Molecular Weight | 508.20 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | [(4S)-4-[(3aS,4S,7S,7aS)-4-acetyloxy-7-bromo-6-(bromomethyl)-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate |
| SMILES | C=C1C(=O)O[C@H]2[C@@H]1[C@H](OC(C)=O)C([C@@H](C)CCCOC(C)=O)=C(CBr)[C@@H]2Br |
| InChI | InChI=1S/C19H24Br2O6/c1-9(6-5-7-25-11(3)22)14-13(8-20)16(21)18-15(10(2)19(24)27-18)17(14)26-12(4)23/h9,15-18H,2,5-8H2,1,3-4H3/t9-,15-,16-,17+,18-/m0/s1 |
| InChIKey | YIJFTAOBFYWIDM-WCNMAMQUSA-N |
| XLogP | 3.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|