C25H29ClN6O5S — CID 164626151
4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[5-(hydroxyamino)-5-oxopentyl]benzamide (PubChem CID 164626151) has the molecular formula C25H29ClN6O5S and a molecular weight of 561.06 g/mol. Its IUPAC name is 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[5-(hydroxyamino)-5-oxopentyl]benzamide.
| Compound Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[5-(hydroxyamino)-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 164626151 |
| Molecular Formula | C25H29ClN6O5S |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[5-(hydroxyamino)-5-oxopentyl]benzamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)NCCCCC(=O)NO)cc2)ncc1Cl |
| InChI | InChI=1S/C25H29ClN6O5S/c1-16(2)38(36,37)21-8-4-3-7-20(21)30-23-19(26)15-28-25(31-23)29-18-12-10-17(11-13-18)24(34)27-14-6-5-9-22(33)32-35/h3-4,7-8,10-13,15-16,35H,5-6,9,14H2,1-2H3,(H,27,34)(H,32,33)(H2,28,29,30,31) |
| InChIKey | SDMFSKKGMRESNZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|