C17H23FN6OS — CID 164626153
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[1-(3-fluorophenyl)ethyl]urea (PubChem CID 164626153) has the molecular formula C17H23FN6OS and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[1-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[1-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 164626153 |
| Molecular Formula | C17H23FN6OS |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[1-(3-fluorophenyl)ethyl]urea |
| SMILES | Cc1nc(N)sc1CCC/N=C(\N)NC(=O)NC(C)c1cccc(F)c1 |
| InChI | InChI=1S/C17H23FN6OS/c1-10(12-5-3-6-13(18)9-12)23-17(25)24-15(19)21-8-4-7-14-11(2)22-16(20)26-14/h3,5-6,9-10H,4,7-8H2,1-2H3,(H2,20,22)(H4,19,21,23,24,25) |
| InChIKey | FFKSIHLRCNTALR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|