C26H38O5 — CID 164626182
(2S)-3-[(2R,6R)-6-hydroxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2-methoxy-2H-furan-5-one (PubChem CID 164626182) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (2S)-3-[(2R,6R)-6-hydroxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2-methoxy-2H-furan-5-one.
| Compound Name | (2S)-3-[(2R,6R)-6-hydroxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2-methoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 164626182 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (2S)-3-[(2R,6R)-6-hydroxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2-methoxy-2H-furan-5-one |
| SMILES | CO[C@H]1OC(=O)C=C1[C@H]1CC=C(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@H](O)O1 |
| InChI | InChI=1S/C26H38O5/c1-18(2)9-6-10-19(3)11-7-12-20(4)13-8-14-21-15-16-23(30-25(21)28)22-17-24(27)31-26(22)29-5/h9,11,13,15,17,23,25-26,28H,6-8,10,12,14,16H2,1-5H3/b19-11+,20-13+/t23-,25-,26+/m1/s1 |
| InChIKey | SSABFWFUJBLGCZ-KKDHUHDUSA-N |
| XLogP | 5.68 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|