C23H22N4O2S — CID 164626202
[5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1H-indol-4-yl)-2,3-dihydroindol-1-yl]methanone (PubChem CID 164626202) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1H-indol-4-yl)-2,3-dihydroindol-1-yl]methanone.
| Compound Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1H-indol-4-yl)-2,3-dihydroindol-1-yl]methanone |
|---|---|
| PubChem CID | 164626202 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [5-[(2-hydroxyethylamino)methyl]-1,3-thiazol-2-yl]-[4-(1H-indol-4-yl)-2,3-dihydroindol-1-yl]methanone |
| SMILES | O=C(c1ncc(CNCCO)s1)N1CCc2c(-c3cccc4[nH]ccc34)cccc21 |
| InChI | InChI=1S/C23H22N4O2S/c28-12-10-24-13-15-14-26-22(30-15)23(29)27-11-8-19-17(4-2-6-21(19)27)16-3-1-5-20-18(16)7-9-25-20/h1-7,9,14,24-25,28H,8,10-13H2 |
| InChIKey | DYTYXLTZPUZRTJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|