C22H25ClN2O3 — CID 164626243
N-[4-[(4aR,10bR)-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide (PubChem CID 164626243) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-[4-[(4aR,10bR)-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide.
| Compound Name | N-[4-[(4aR,10bR)-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 164626243 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[4-[(4aR,10bR)-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide |
| SMILES | O=C(NCCCCN1CCO[C@@H]2c3ccccc3OC[C@H]21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H25ClN2O3/c23-17-9-7-16(8-10-17)22(26)24-11-3-4-12-25-13-14-27-21-18-5-1-2-6-20(18)28-15-19(21)25/h1-2,5-10,19,21H,3-4,11-15H2,(H,24,26)/t19-,21-/m1/s1 |
| InChIKey | RLHNDTLEKOCIPV-TZIWHRDSSA-N |
| XLogP | 3.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|