C22H16F3N5O6 — CID 164626245
(3S,3'R,4'S,5'R)-3'-(3-methyl-4-nitro-1,2-oxazol-5-yl)-5-nitro-4'-phenyl-5'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 164626245) has the molecular formula C22H16F3N5O6 and a molecular weight of 503.39 g/mol. Its IUPAC name is (3S,3'R,4'S,5'R)-3'-(3-methyl-4-nitro-1,2-oxazol-5-yl)-5-nitro-4'-phenyl-5'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'R,4'S,5'R)-3'-(3-methyl-4-nitro-1,2-oxazol-5-yl)-5-nitro-4'-phenyl-5'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 164626245 |
| Molecular Formula | C22H16F3N5O6 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | (3S,3'R,4'S,5'R)-3'-(3-methyl-4-nitro-1,2-oxazol-5-yl)-5-nitro-4'-phenyl-5'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | Cc1noc([C@@H]2[C@@H](c3ccccc3)[C@H](C(F)(F)F)N[C@@]23C(=O)Nc2ccc([N+](=O)[O-])cc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16F3N5O6/c1-10-17(30(34)35)18(36-28-10)16-15(11-5-3-2-4-6-11)19(22(23,24)25)27-21(16)13-9-12(29(32)33)7-8-14(13)26-20(21)31/h2-9,15-16,19,27H,1H3,(H,26,31)/t15-,16+,19-,21-/m1/s1 |
| InChIKey | VYZCVOJLTFWRDL-NNNWTRQLSA-N |
| XLogP | 4.05 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|