C25H25NO5 — CID 164626387
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl quinoline-6-carboxylate (PubChem CID 164626387) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl quinoline-6-carboxylate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl quinoline-6-carboxylate |
|---|---|
| PubChem CID | 164626387 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl quinoline-6-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)c1ccc3ncccc3c1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C25H25NO5/c1-15-19-9-7-16(5-3-11-25(2)22(31-25)21(19)30-23(15)27)14-29-24(28)18-8-10-20-17(13-18)6-4-12-26-20/h4-6,8,10,12-13,19,21-22H,1,3,7,9,11,14H2,2H3/b16-5+/t19-,21-,22-,25+/m0/s1 |
| InChIKey | DQKJRLFKTVLPBX-FPDLSIJQSA-N |
| XLogP | 4.15 |
| TPSA | 78.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|