C36H36O10S — CID 164626397
(E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid (PubChem CID 164626397) has the molecular formula C36H36O10S and a molecular weight of 660.74 g/mol. Its IUPAC name is (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid.
| Compound Name | (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 164626397 |
| Molecular Formula | C36H36O10S |
| Molecular Weight | 660.74 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-9-[(4-methylsulfonylphenyl)methoxy]-6-oxopyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid |
| SMILES | COc1c(OCc2ccc(S(C)(=O)=O)cc2)cc2oc3cc4c(c(OC/C=C/C(=O)O)c3c(=O)c2c1CC=C(C)C)C=CC(C)(C)O4 |
| InChI | InChI=1S/C36H36O10S/c1-21(2)9-14-25-31-27(19-29(34(25)42-5)44-20-22-10-12-23(13-11-22)47(6,40)41)45-28-18-26-24(15-16-36(3,4)46-26)35(32(28)33(31)39)43-17-7-8-30(37)38/h7-13,15-16,18-19H,14,17,20H2,1-6H3,(H,37,38)/b8-7+ |
| InChIKey | LRXXJRGDLISKGD-BQYQJAHWSA-N |
| XLogP | 6.65 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|