C22H15N3S — CID 164626400
1,3-diphenyl-4-thiophen-2-ylpyrazolo[3,4-b]pyridine (PubChem CID 164626400) has the molecular formula C22H15N3S and a molecular weight of 353.45 g/mol. Its IUPAC name is 1,3-diphenyl-4-thiophen-2-ylpyrazolo[3,4-b]pyridine.
| Compound Name | 1,3-diphenyl-4-thiophen-2-ylpyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 164626400 |
| Molecular Formula | C22H15N3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 1,3-diphenyl-4-thiophen-2-ylpyrazolo[3,4-b]pyridine |
| SMILES | c1ccc(-c2nn(-c3ccccc3)c3nccc(-c4cccs4)c23)cc1 |
| InChI | InChI=1S/C22H15N3S/c1-3-8-16(9-4-1)21-20-18(19-12-7-15-26-19)13-14-23-22(20)25(24-21)17-10-5-2-6-11-17/h1-15H |
| InChIKey | KHEWMKNNKQJGHS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |