C31H39N3O5 — CID 164626468
6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]-2,2-dimethylhexanoic acid (PubChem CID 164626468) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is 6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 164626468 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | 6-[[(2S)-2-cyclopentyl-2-[4-[(5-oxo-2-phenyl-1,3,4-oxadiazin-4-yl)methyl]phenyl]acetyl]amino]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCNC(=O)[C@H](c1ccc(CN2N=C(c3ccccc3)OCC2=O)cc1)C1CCCC1)C(=O)O |
| InChI | InChI=1S/C31H39N3O5/c1-31(2,30(37)38)18-8-9-19-32-28(36)27(23-10-6-7-11-23)24-16-14-22(15-17-24)20-34-26(35)21-39-29(33-34)25-12-4-3-5-13-25/h3-5,12-17,23,27H,6-11,18-21H2,1-2H3,(H,32,36)(H,37,38)/t27-/m0/s1 |
| InChIKey | HHYFZEZPFUUQOZ-MHZLTWQESA-N |
| XLogP | 5.08 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|