C21H26N2O4 — CID 164626494
(1R,2S,4S,5S,7Z,8R,9S)-7-ethylidene-1'-methoxy-5-methyl-5-oxidospiro[11-oxa-5-azoniatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one (PubChem CID 164626494) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1R,2S,4S,5S,7Z,8R,9S)-7-ethylidene-1'-methoxy-5-methyl-5-oxidospiro[11-oxa-5-azoniatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one.
| Compound Name | (1R,2S,4S,5S,7Z,8R,9S)-7-ethylidene-1'-methoxy-5-methyl-5-oxidospiro[11-oxa-5-azoniatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 164626494 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1R,2S,4S,5S,7Z,8R,9S)-7-ethylidene-1'-methoxy-5-methyl-5-oxidospiro[11-oxa-5-azoniatricyclo[6.3.1.04,9]dodecane-2,3'-indole]-2'-one |
| SMILES | C/C=C1\C[N@+](C)([O-])[C@H]2C[C@@]3(C(=O)N(OC)c4ccccc43)[C@H]3C[C@@H]1[C@@H]2CO3 |
| InChI | InChI=1S/C21H26N2O4/c1-4-13-11-23(2,25)18-10-21(19-9-14(13)15(18)12-27-19)16-7-5-6-8-17(16)22(26-3)20(21)24/h4-8,14-15,18-19H,9-12H2,1-3H3/b13-4+/t14-,15-,18-,19+,21-,23-/m0/s1 |
| InChIKey | UIBRWIGMJWWIGU-JGCRRYOSSA-N |
| XLogP | 2.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|