C35H26F3NO3 — CID 164626883
2-[1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid (PubChem CID 164626883) has the molecular formula C35H26F3NO3 and a molecular weight of 565.59 g/mol. Its IUPAC name is 2-[1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid.
| Compound Name | 2-[1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 164626883 |
| Molecular Formula | C35H26F3NO3 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-[1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1cccc2c1c(-c1cccc(C(F)(F)F)c1)cn2CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C35H26F3NO3/c36-35(37,38)25-12-5-11-24(21-25)30-22-39(19-8-20-42-32-18-6-10-23-9-1-2-13-26(23)32)31-17-7-16-28(33(30)31)27-14-3-4-15-29(27)34(40)41/h1-7,9-18,21-22H,8,19-20H2,(H,40,41) |
| InChIKey | JVXSOXGWGXURMC-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|