C34H47NO2 — CID 164626967
(3S,8S,9R,10R,11R,13R,14S,17R)-4,4,9,13,14-pentamethyl-17-[(2R)-1-quinolin-3-ylpropan-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol (PubChem CID 164626967) has the molecular formula C34H47NO2 and a molecular weight of 501.76 g/mol. Its IUPAC name is (3S,8S,9R,10R,11R,13R,14S,17R)-4,4,9,13,14-pentamethyl-17-[(2R)-1-quinolin-3-ylpropan-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (3S,8S,9R,10R,11R,13R,14S,17R)-4,4,9,13,14-pentamethyl-17-[(2R)-1-quinolin-3-ylpropan-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 164626967 |
| Molecular Formula | C34H47NO2 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | (3S,8S,9R,10R,11R,13R,14S,17R)-4,4,9,13,14-pentamethyl-17-[(2R)-1-quinolin-3-ylpropan-2-yl]-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11-diol |
| SMILES | C[C@H](Cc1cnc2ccccc2c1)[C@H]1CC[C@@]2(C)[C@@H]3CC=C4[C@@H](CC[C@H](O)C4(C)C)[C@]3(C)[C@H](O)C[C@]12C |
| InChI | InChI=1S/C34H47NO2/c1-21(17-22-18-23-9-7-8-10-27(23)35-20-22)24-15-16-32(4)28-13-11-25-26(12-14-29(36)31(25,2)3)34(28,6)30(37)19-33(24,32)5/h7-11,18,20-21,24,26,28-30,36-37H,12-17,19H2,1-6H3/t21-,24-,26-,28+,29+,30-,32+,33-,34+/m1/s1 |
| InChIKey | ITPSILKBIXSBQU-GSXLEOJMSA-N |
| XLogP | 7.35 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|