C39H50F2N5O3+ — CID 164627003
cyclohexyl-[7-[5-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-2-methylphenoxy]heptyl]-dimethylazanium (PubChem CID 164627003) has the molecular formula C39H50F2N5O3+ and a molecular weight of 674.86 g/mol. Its IUPAC name is cyclohexyl-[7-[5-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-2-methylphenoxy]heptyl]-dimethylazanium.
| Compound Name | cyclohexyl-[7-[5-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-2-methylphenoxy]heptyl]-dimethylazanium |
|---|---|
| PubChem CID | 164627003 |
| Molecular Formula | C39H50F2N5O3+ |
| Molecular Weight | 674.86 g/mol |
| Exact Mass | 674.39 |
| IUPAC Name | cyclohexyl-[7-[5-[3-[(3,5-difluorophenyl)carbamoyl]-7-(dimethylamino)-4-oxo-1,8-naphthyridin-1-yl]-2-methylphenoxy]heptyl]-dimethylazanium |
| SMILES | Cc1ccc(-n2cc(C(=O)Nc3cc(F)cc(F)c3)c(=O)c3ccc(N(C)C)nc32)cc1OCCCCCCC[N+](C)(C)C1CCCCC1 |
| InChI | InChI=1S/C39H49F2N5O3/c1-27-16-17-31(25-35(27)49-21-13-8-6-7-12-20-46(4,5)32-14-10-9-11-15-32)45-26-34(39(48)42-30-23-28(40)22-29(41)24-30)37(47)33-18-19-36(44(2)3)43-38(33)45/h16-19,22-26,32H,6-15,20-21H2,1-5H3/p+1 |
| InChIKey | FPQDVEHONWQMPV-UHFFFAOYSA-O |
| XLogP | 8.03 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.86 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|