C35H40N6O9 — CID 164627021
methyl (2S)-2-[[2-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 164627021) has the molecular formula C35H40N6O9 and a molecular weight of 688.74 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2-[[2-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 164627021 |
| Molecular Formula | C35H40N6O9 |
| Molecular Weight | 688.74 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | methyl (2S)-2-[[2-[[2-oxo-2-[(2S)-1-[2-(quinoline-4-carbonylamino)acetyl]pyrrolidin-2-yl]acetyl]amino]acetyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)CNC(=O)C(=O)[C@@H]1CCCN1C(=O)CNC(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C35H40N6O9/c1-49-34(47)27(14-7-8-17-37-35(48)50-22-23-10-3-2-4-11-23)40-29(42)20-38-33(46)31(44)28-15-9-19-41(28)30(43)21-39-32(45)25-16-18-36-26-13-6-5-12-24(25)26/h2-6,10-13,16,18,27-28H,7-9,14-15,17,19-22H2,1H3,(H,37,48)(H,38,46)(H,39,45)(H,40,42)/t27-,28-/m0/s1 |
| InChIKey | IQICLVVSOBZEBA-NSOVKSMOSA-N |
| XLogP | 1.40 |
| TPSA | 202.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.74 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|