C17H20F3N5O2S — CID 164627060
4-N-(4-aminocyclohexyl)-2-methylsulfonyl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 164627060) has the molecular formula C17H20F3N5O2S and a molecular weight of 415.44 g/mol. Its IUPAC name is 4-N-(4-aminocyclohexyl)-2-methylsulfonyl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-aminocyclohexyl)-2-methylsulfonyl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 164627060 |
| Molecular Formula | C17H20F3N5O2S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-N-(4-aminocyclohexyl)-2-methylsulfonyl-6-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CS(=O)(=O)c1nc(Nc2cc(F)c(F)c(F)c2)cc(NC2CCC(N)CC2)n1 |
| InChI | InChI=1S/C17H20F3N5O2S/c1-28(26,27)17-24-14(22-10-4-2-9(21)3-5-10)8-15(25-17)23-11-6-12(18)16(20)13(19)7-11/h6-10H,2-5,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | QKOBNKDHLHQDAM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|