C14H25N3O4 — CID 164627062
(2R)-2,4-dihydroxy-3,3-dimethyl-N-[(5-pentyl-1,2,4-oxadiazol-3-yl)methyl]butanamide (PubChem CID 164627062) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-[(5-pentyl-1,2,4-oxadiazol-3-yl)methyl]butanamide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[(5-pentyl-1,2,4-oxadiazol-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 164627062 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[(5-pentyl-1,2,4-oxadiazol-3-yl)methyl]butanamide |
| SMILES | CCCCCc1nc(CNC(=O)[C@H](O)C(C)(C)CO)no1 |
| InChI | InChI=1S/C14H25N3O4/c1-4-5-6-7-11-16-10(17-21-11)8-15-13(20)12(19)14(2,3)9-18/h12,18-19H,4-9H2,1-3H3,(H,15,20)/t12-/m0/s1 |
| InChIKey | XRAVRNYSXMAUDZ-LBPRGKRZSA-N |
| XLogP | 0.80 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|