About methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate
methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate (PubChem CID 164627102) has the molecular formula C21H17F2N5O3
and a molecular weight of 425.40 g/mol. Its IUPAC name is methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate |
| PubChem CID | 164627102 |
| Molecular Formula | C21H17F2N5O3 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(-n2cnc3cnc(Nc4cc(F)c(O)c(F)c4)nc32)cc1 |
| InChI | InChI=1S/C21H17F2N5O3/c1-31-18(29)7-4-12-2-5-14(6-3-12)28-11-25-17-10-24-21(27-20(17)28)26-13-8-15(22)19(30)16(23)9-13/h2-3,5-6,8-11,30H,4,7H2,1H3,(H,24,26,27) |
| InChIKey | DKBLAYGVRVTXEZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate?
The IUPAC name of methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate (CID 164627102) is methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate.
What is the SMILES notation for methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate?
The canonical SMILES for methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate is COC(=O)CCc1ccc(-n2cnc3cnc(Nc4cc(F)c(O)c(F)c4)nc32)cc1.
What is the InChIKey of methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate?
The InChIKey is DKBLAYGVRVTXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F2N5O3/c1-31-18(29)7-4-12-2-5-14(6-3-12)28-11-25-17-10-24-21(27-20(17)28)26-13-8-15(22)19(30)16(23)9-13/h2-3,5-6,8-11,30H,4,7H2,1H3,(H,24,26,27).
What are the key properties of methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate?
methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate has a molecular weight of 425.40 g/mol, XLogP of 3.65, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]propanoate is sourced from PubChem (CID 164627102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).