C40H42N6O5 — CID 164627190
methyl (17S,18S)-12-ethenyl-7-ethyl-18-[3-[4-(hydroxycarbamoyl)anilino]-3-oxopropyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 164627190) has the molecular formula C40H42N6O5 and a molecular weight of 686.81 g/mol. Its IUPAC name is methyl (17S,18S)-12-ethenyl-7-ethyl-18-[3-[4-(hydroxycarbamoyl)anilino]-3-oxopropyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | methyl (17S,18S)-12-ethenyl-7-ethyl-18-[3-[4-(hydroxycarbamoyl)anilino]-3-oxopropyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 164627190 |
| Molecular Formula | C40H42N6O5 |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | methyl (17S,18S)-12-ethenyl-7-ethyl-18-[3-[4-(hydroxycarbamoyl)anilino]-3-oxopropyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | C=Cc1c(C)c2cc3nc(cc4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)OC)[C@@H](CCC(=O)Nc1ccc(C(=O)NO)cc1)[C@@H]3C |
| InChI | InChI=1S/C40H42N6O5/c1-8-26-20(3)29-16-30-22(5)28(14-15-37(47)41-25-12-10-24(11-13-25)39(48)46-50)35(44-30)19-36-38(40(49)51-7)23(6)32(45-36)18-34-27(9-2)21(4)31(43-34)17-33(26)42-29/h8,10-13,16-19,22,28,42-43,50H,1,9,14-15H2,2-7H3,(H,41,47)(H,46,48)/b29-16-,30-16-,31-17-,32-18-,33-17-,34-18-,35-19-,36-19-/t22-,28-/m0/s1 |
| InChIKey | NERDYXILATYFDG-RTQJYEKJSA-N |
| XLogP | 7.67 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|