C27H33F3N4O — CID 164627269
2,2-difluoro-3-[(1R,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol (PubChem CID 164627269) has the molecular formula C27H33F3N4O and a molecular weight of 486.58 g/mol. Its IUPAC name is 2,2-difluoro-3-[(1R,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[(1R,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 164627269 |
| Molecular Formula | C27H33F3N4O |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2,2-difluoro-3-[(1R,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(NC3CN(CCCF)C3)cc2)N1CC(F)(F)CO |
| InChI | InChI=1S/C27H33F3N4O/c1-18-13-23-22-5-2-3-6-24(22)32-25(23)26(34(18)16-27(29,30)17-35)19-7-9-20(10-8-19)31-21-14-33(15-21)12-4-11-28/h2-3,5-10,18,21,26,31-32,35H,4,11-17H2,1H3/t18-,26-/m1/s1 |
| InChIKey | XVPFWZJURVBDQK-WXTAPIANSA-N |
| XLogP | 4.59 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|