C31H33NO7 — CID 164627335
1-O-[(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-O-[4-(5-methyl-2-oxo-1-pyridinyl)phenyl] butanedioate (PubChem CID 164627335) has the molecular formula C31H33NO7 and a molecular weight of 531.61 g/mol. Its IUPAC name is 1-O-[(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-O-[4-(5-methyl-2-oxo-1-pyridinyl)phenyl] butanedioate.
| Compound Name | 1-O-[(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-O-[4-(5-methyl-2-oxo-1-pyridinyl)phenyl] butanedioate |
|---|---|
| PubChem CID | 164627335 |
| Molecular Formula | C31H33NO7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 1-O-[(3aS,5aR,6R,9aS,9bS)-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,9a,9b-hexahydro-3aH-benzo[g][1]benzofuran-6-yl] 4-O-[4-(5-methyl-2-oxo-1-pyridinyl)phenyl] butanedioate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(C)=CC[C@@H](OC(=O)CCC(=O)Oc4ccc(-n5cc(C)ccc5=O)cc4)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C31H33NO7/c1-18-5-12-25(33)32(17-18)21-7-9-22(10-8-21)37-26(34)13-14-27(35)38-24-11-6-19(2)28-29-23(15-16-31(24,28)4)20(3)30(36)39-29/h5-10,12,17,23-24,28-29H,3,11,13-16H2,1-2,4H3/t23-,24+,28+,29-,31-/m0/s1 |
| InChIKey | NBONJBNHMVIDJP-DOEXHEHBSA-N |
| XLogP | 4.61 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|