C22H34O3 — CID 164627455
[(1S,2Z,4E,7E,12E)-9-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,7,12-tetraen-1-yl] acetate (PubChem CID 164627455) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1S,2Z,4E,7E,12E)-9-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,7,12-tetraen-1-yl] acetate.
| Compound Name | [(1S,2Z,4E,7E,12E)-9-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,7,12-tetraen-1-yl] acetate |
|---|---|
| PubChem CID | 164627455 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1S,2Z,4E,7E,12E)-9-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,7,12-tetraen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C(C)=C/CCC(C)(O)/C=C/C/C(C)=C/C=C\1C(C)C |
| InChI | InChI=1S/C22H34O3/c1-16(2)20-12-11-17(3)9-7-13-22(6,24)14-8-10-18(4)15-21(20)25-19(5)23/h7,10-13,16,21,24H,8-9,14-15H2,1-6H3/b13-7+,17-11+,18-10+,20-12-/t21-,22?/m0/s1 |
| InChIKey | LDKSIJIDJWKQSA-XZIZHBNXSA-N |
| XLogP | 5.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|