C12H10Cl2N2 — CID 164627477
7,8-dichloro-4-methyl-4,5-dihydropyrrolo[1,2-a]quinoxaline (PubChem CID 164627477) has the molecular formula C12H10Cl2N2 and a molecular weight of 253.13 g/mol. Its IUPAC name is 7,8-dichloro-4-methyl-4,5-dihydropyrrolo[1,2-a]quinoxaline.
| Compound Name | 7,8-dichloro-4-methyl-4,5-dihydropyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 164627477 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 7,8-dichloro-4-methyl-4,5-dihydropyrrolo[1,2-a]quinoxaline |
| SMILES | CC1Nc2cc(Cl)c(Cl)cc2-n2cccc21 |
| InChI | InChI=1S/C12H10Cl2N2/c1-7-11-3-2-4-16(11)12-6-9(14)8(13)5-10(12)15-7/h2-7,15H,1H3 |
| InChIKey | OTERRZWCUBMXGQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |