About 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide
5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 164627563) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide |
| PubChem CID | 164627563 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(N)c1C(=O)N[C@H]1COCC1(C)C |
| InChI | InChI=1S/C12H20N4O2/c1-7-9(10(13)16(4)15-7)11(17)14-8-5-18-6-12(8,2)3/h8H,5-6,13H2,1-4H3,(H,14,17)/t8-/m0/s1 |
| InChIKey | ZQAZLEJOLVLUAF-QMMMGPOBSA-N |
| XLogP | 0.47 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide?
The IUPAC name of 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide (CID 164627563) is 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide?
The canonical SMILES for 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide is Cc1nn(C)c(N)c1C(=O)N[C@H]1COCC1(C)C.
What is the InChIKey of 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide?
The InChIKey is ZQAZLEJOLVLUAF-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-7-9(10(13)16(4)15-7)11(17)14-8-5-18-6-12(8,2)3/h8H,5-6,13H2,1-4H3,(H,14,17)/t8-/m0/s1.
What are the key properties of 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide?
5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide has a molecular weight of 252.32 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-[(3R)-4,4-dimethyloxolan-3-yl]-1,3-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 164627563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).