About N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine
N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine (PubChem CID 164627693) has the molecular formula C26H26N6S
and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine |
| PubChem CID | 164627693 |
| Molecular Formula | C26H26N6S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4scc(-c5ccc6cc[nH]c6c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C26H26N6S/c1-2-31-11-13-32(14-12-31)21-7-5-20(6-8-21)29-26-28-16-24-25(30-26)22(17-33-24)19-4-3-18-9-10-27-23(18)15-19/h3-10,15-17,27H,2,11-14H2,1H3,(H,28,29,30) |
| InChIKey | STFJXIHVZCMTHO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine?
The IUPAC name of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine (CID 164627693) is N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine?
The canonical SMILES for N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine is CCN1CCN(c2ccc(Nc3ncc4scc(-c5ccc6cc[nH]c6c5)c4n3)cc2)CC1.
What is the InChIKey of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine?
The InChIKey is STFJXIHVZCMTHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N6S/c1-2-31-11-13-32(14-12-31)21-7-5-20(6-8-21)29-26-28-16-24-25(30-26)22(17-33-24)19-4-3-18-9-10-27-23(18)15-19/h3-10,15-17,27H,2,11-14H2,1H3,(H,28,29,30).
What are the key properties of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine?
N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine has a molecular weight of 454.60 g/mol, XLogP of 5.73, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-(1H-indol-6-yl)thieno[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 164627693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).