C31H34O8 — CID 164627709
(E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxo-9-propan-2-yloxypyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid (PubChem CID 164627709) has the molecular formula C31H34O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxo-9-propan-2-yloxypyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid.
| Compound Name | (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxo-9-propan-2-yloxypyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 164627709 |
| Molecular Formula | C31H34O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (E)-4-[8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-6-oxo-9-propan-2-yloxypyrano[3,2-b]xanthen-5-yl]oxybut-2-enoic acid |
| SMILES | COc1c(OC(C)C)cc2oc3cc4c(c(OC/C=C/C(=O)O)c3c(=O)c2c1CC=C(C)C)C=CC(C)(C)O4 |
| InChI | InChI=1S/C31H34O8/c1-17(2)10-11-20-26-22(16-24(29(20)35-7)37-18(3)4)38-23-15-21-19(12-13-31(5,6)39-21)30(27(23)28(26)34)36-14-8-9-25(32)33/h8-10,12-13,15-16,18H,11,14H2,1-7H3,(H,32,33)/b9-8+ |
| InChIKey | GTNBLEOKNYOAEK-CMDGGOBGSA-N |
| XLogP | 6.45 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|