About 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile
2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile (PubChem CID 164627799) has the molecular formula C17H14N4O2
and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile |
| PubChem CID | 164627799 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile |
| SMILES | COc1ccc(-n2cnc3c(C#N)c4n(c3c2=O)CCC4)cc1 |
| InChI | InChI=1S/C17H14N4O2/c1-23-12-6-4-11(5-7-12)21-10-19-15-13(9-18)14-3-2-8-20(14)16(15)17(21)22/h4-7,10H,2-3,8H2,1H3 |
| InChIKey | IHCRDCXIQLUCJY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile?
The IUPAC name of 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile (CID 164627799) is 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile.
What is the SMILES notation for 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile?
The canonical SMILES for 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile is COc1ccc(-n2cnc3c(C#N)c4n(c3c2=O)CCC4)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile?
The InChIKey is IHCRDCXIQLUCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O2/c1-23-12-6-4-11(5-7-12)21-10-19-15-13(9-18)14-3-2-8-20(14)16(15)17(21)22/h4-7,10H,2-3,8H2,1H3.
What are the key properties of 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile?
2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile has a molecular weight of 306.33 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-1-oxo-7,8-dihydro-6H-pyrimido[4,5-b]pyrrolizine-5-carbonitrile is sourced from PubChem (CID 164627799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).