About 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine
3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine (PubChem CID 164627889) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine.
Molecular Properties
| Compound Name | 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine |
| PubChem CID | 164627889 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine |
| SMILES | COc1ccc2c(c1)Cc1ccc(OC)cc1NC2 |
| InChI | InChI=1S/C16H17NO2/c1-18-14-6-4-12-10-17-16-9-15(19-2)5-3-11(16)7-13(12)8-14/h3-6,8-9,17H,7,10H2,1-2H3 |
| InChIKey | HHXSBOKXALIJFW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine?
The IUPAC name of 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine (CID 164627889) is 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine.
What is the SMILES notation for 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine?
The canonical SMILES for 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine is COc1ccc2c(c1)Cc1ccc(OC)cc1NC2.
What is the InChIKey of 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine?
The InChIKey is HHXSBOKXALIJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-18-14-6-4-12-10-17-16-9-15(19-2)5-3-11(16)7-13(12)8-14/h3-6,8-9,17H,7,10H2,1-2H3.
What are the key properties of 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine?
3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine has a molecular weight of 255.32 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,9-dimethoxy-6,11-dihydro-5H-benzo[c][1]benzazepine is sourced from PubChem (CID 164627889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).