C12H16O2 — CID 164627891
(1R)-1-propan-2-yl-1,2,3,3a-tetrahydroindene-4,6-dione (PubChem CID 164627891) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R)-1-propan-2-yl-1,2,3,3a-tetrahydroindene-4,6-dione.
| Compound Name | (1R)-1-propan-2-yl-1,2,3,3a-tetrahydroindene-4,6-dione |
|---|---|
| PubChem CID | 164627891 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1R)-1-propan-2-yl-1,2,3,3a-tetrahydroindene-4,6-dione |
| SMILES | CC(C)[C@H]1CCC2C(=O)CC(=O)C=C21 |
| InChI | InChI=1S/C12H16O2/c1-7(2)9-3-4-10-11(9)5-8(13)6-12(10)14/h5,7,9-10H,3-4,6H2,1-2H3/t9-,10?/m1/s1 |
| InChIKey | GWOACMXGMBUZBT-YHMJZVADSA-N |
| XLogP | 2.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|