C20H15F3N4O2 — CID 164627909
4-(4-methoxyphenyl)-6-prop-1-ynyl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 164627909) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-prop-1-ynyl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-methoxyphenyl)-6-prop-1-ynyl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 164627909 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-prop-1-ynyl-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | CC#Cc1nc(Nc2ccc(OC(F)(F)F)cc2)nc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C20H15F3N4O2/c1-3-4-17-25-18(13-5-9-15(28-2)10-6-13)27-19(26-17)24-14-7-11-16(12-8-14)29-20(21,22)23/h5-12H,1-2H3,(H,24,25,26,27) |
| InChIKey | RIKLROXKTGNTRD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|