About 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide
2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 164628081) has the molecular formula C21H15F3N4OS
and a molecular weight of 428.44 g/mol. Its IUPAC name is 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 164628081 |
| Molecular Formula | C21H15F3N4OS |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(Nc2ncnc3ccsc23)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F3N4OS/c22-21(23,24)14-2-1-3-16(11-14)27-18(29)10-13-4-6-15(7-5-13)28-20-19-17(8-9-30-19)25-12-26-20/h1-9,11-12H,10H2,(H,27,29)(H,25,26,28) |
| InChIKey | WLBYQFQSNKYYOI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide (CID 164628081) is 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide is O=C(Cc1ccc(Nc2ncnc3ccsc23)cc1)Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide?
The InChIKey is WLBYQFQSNKYYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F3N4OS/c22-21(23,24)14-2-1-3-16(11-14)27-18(29)10-13-4-6-15(7-5-13)28-20-19-17(8-9-30-19)25-12-26-20/h1-9,11-12H,10H2,(H,27,29)(H,25,26,28).
What are the key properties of 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide?
2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide has a molecular weight of 428.44 g/mol, XLogP of 5.63, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(thieno[3,2-d]pyrimidin-4-ylamino)phenyl]-N-[3-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 164628081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).