C21H28O6 — CID 164628245
(1S,2S,5S,7S,10S)-5-hydroxy-13-methoxy-2,6,6-trimethyl-12-propan-2-yl-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-12-ene-9,11,14-trione (PubChem CID 164628245) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (1S,2S,5S,7S,10S)-5-hydroxy-13-methoxy-2,6,6-trimethyl-12-propan-2-yl-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-12-ene-9,11,14-trione.
| Compound Name | (1S,2S,5S,7S,10S)-5-hydroxy-13-methoxy-2,6,6-trimethyl-12-propan-2-yl-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-12-ene-9,11,14-trione |
|---|---|
| PubChem CID | 164628245 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1S,2S,5S,7S,10S)-5-hydroxy-13-methoxy-2,6,6-trimethyl-12-propan-2-yl-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-12-ene-9,11,14-trione |
| SMILES | COC1=C(C(C)C)C(=O)[C@]23O[C@@]2(C1=O)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3=O |
| InChI | InChI=1S/C21H28O6/c1-10(2)14-15(26-6)17(25)21-19(5)8-7-12(22)18(3,4)11(19)9-13(23)20(21,27-21)16(14)24/h10-12,22H,7-9H2,1-6H3/t11-,12-,19-,20-,21-/m0/s1 |
| InChIKey | ATVBDXTZABMEPI-XEHFDHBKSA-N |
| XLogP | 1.98 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|