C18H28ClN7O3 — CID 164628301
4-amino-N-[(2S)-1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide;hydrochloride (PubChem CID 164628301) has the molecular formula C18H28ClN7O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 4-amino-N-[(2S)-1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[(2S)-1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 164628301 |
| Molecular Formula | C18H28ClN7O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-amino-N-[(2S)-1-(hydroxyamino)-4-methyl-1-oxopentan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CC(C)C[C@H](NC(=O)C1(N)CCN(c2ncnc3[nH]ccc23)CC1)C(=O)NO.Cl |
| InChI | InChI=1S/C18H27N7O3.ClH/c1-11(2)9-13(16(26)24-28)23-17(27)18(19)4-7-25(8-5-18)15-12-3-6-20-14(12)21-10-22-15;/h3,6,10-11,13,28H,4-5,7-9,19H2,1-2H3,(H,23,27)(H,24,26)(H,20,21,22);1H/t13-;/m0./s1 |
| InChIKey | SXTZTWBCXVRWOK-ZOWNYOTGSA-N |
| XLogP | 0.71 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|