About N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide (PubChem CID 164628449) has the molecular formula C18H15BN2O3S
and a molecular weight of 350.21 g/mol. Its IUPAC name is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide |
| PubChem CID | 164628449 |
| Molecular Formula | C18H15BN2O3S |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide |
| SMILES | Cc1c(-c2ccccn2)csc1C(=O)Nc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C18H15BN2O3S/c1-11-14(16-4-2-3-7-20-16)10-25-17(11)18(22)21-13-6-5-12-9-24-19(23)15(12)8-13/h2-8,10,23H,9H2,1H3,(H,21,22) |
| InChIKey | FCNYXSWSHVUVKQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide?
The IUPAC name of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide (CID 164628449) is N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide.
What is the SMILES notation for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide?
The canonical SMILES for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide is Cc1c(-c2ccccn2)csc1C(=O)Nc1ccc2c(c1)B(O)OC2.
What is the InChIKey of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide?
The InChIKey is FCNYXSWSHVUVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BN2O3S/c1-11-14(16-4-2-3-7-20-16)10-25-17(11)18(22)21-13-6-5-12-9-24-19(23)15(12)8-13/h2-8,10,23H,9H2,1H3,(H,21,22).
What are the key properties of N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide?
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide has a molecular weight of 350.21 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-methyl-4-pyridin-2-ylthiophene-2-carboxamide is sourced from PubChem (CID 164628449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).