About 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine
4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine (PubChem CID 164628472) has the molecular formula C23H31NO
and a molecular weight of 337.51 g/mol. Its IUPAC name is 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine.
Molecular Properties
| Compound Name | 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine |
| PubChem CID | 164628472 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine |
| SMILES | c1ccc(CCCCNCC[C@@H]2CCC[C@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C23H31NO/c1-3-10-20(11-4-1)12-7-8-18-24-19-17-22-15-9-16-23(25-22)21-13-5-2-6-14-21/h1-6,10-11,13-14,22-24H,7-9,12,15-19H2/t22-,23+/m0/s1 |
| InChIKey | YCHGZGNVHTXWHU-XZOQPEGZSA-N |
| XLogP | 5.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine?
The IUPAC name of 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine (CID 164628472) is 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine.
What is the SMILES notation for 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine?
The canonical SMILES for 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine is c1ccc(CCCCNCC[C@@H]2CCC[C@H](c3ccccc3)O2)cc1.
What is the InChIKey of 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine?
The InChIKey is YCHGZGNVHTXWHU-XZOQPEGZSA-N. The full InChI is InChI=1S/C23H31NO/c1-3-10-20(11-4-1)12-7-8-18-24-19-17-22-15-9-16-23(25-22)21-13-5-2-6-14-21/h1-6,10-11,13-14,22-24H,7-9,12,15-19H2/t22-,23+/m0/s1.
What are the key properties of 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine?
4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine has a molecular weight of 337.51 g/mol, XLogP of 5.30, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-N-[2-[(2S,6R)-6-phenyloxan-2-yl]ethyl]butan-1-amine is sourced from PubChem (CID 164628472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).