About 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole
2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole (PubChem CID 164628501) has the molecular formula C20H10F3N3S
and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole |
| PubChem CID | 164628501 |
| Molecular Formula | C20H10F3N3S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole |
| SMILES | Fc1cc2c(-c3ccc4c(-c5nccs5)cccc4n3)c[nH]c2c(F)c1F |
| InChI | InChI=1S/C20H10F3N3S/c21-14-8-12-13(9-25-19(12)18(23)17(14)22)16-5-4-10-11(20-24-6-7-27-20)2-1-3-15(10)26-16/h1-9,25H |
| InChIKey | JTDBZHLRXRQETN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole?
The IUPAC name of 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole (CID 164628501) is 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole.
What is the SMILES notation for 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole?
The canonical SMILES for 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole is Fc1cc2c(-c3ccc4c(-c5nccs5)cccc4n3)c[nH]c2c(F)c1F.
What is the InChIKey of 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole?
The InChIKey is JTDBZHLRXRQETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10F3N3S/c21-14-8-12-13(9-25-19(12)18(23)17(14)22)16-5-4-10-11(20-24-6-7-27-20)2-1-3-15(10)26-16/h1-9,25H.
What are the key properties of 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole?
2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole has a molecular weight of 381.38 g/mol, XLogP of 5.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5,6,7-trifluoro-1H-indol-3-yl)quinolin-5-yl]-1,3-thiazole is sourced from PubChem (CID 164628501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).