About 1-(N'-ethylcarbamimidoyl)-3-propylurea
1-(N'-ethylcarbamimidoyl)-3-propylurea (PubChem CID 164628516) has the molecular formula C7H16N4O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-(N'-ethylcarbamimidoyl)-3-propylurea.
Molecular Properties
| Compound Name | 1-(N'-ethylcarbamimidoyl)-3-propylurea |
| PubChem CID | 164628516 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-(N'-ethylcarbamimidoyl)-3-propylurea |
| SMILES | CCCNC(=O)N/C(N)=N/CC |
| InChI | InChI=1S/C7H16N4O/c1-3-5-10-7(12)11-6(8)9-4-2/h3-5H2,1-2H3,(H4,8,9,10,11,12) |
| InChIKey | VGZVSWZMWFCBKN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(N'-ethylcarbamimidoyl)-3-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N'-ethylcarbamimidoyl)-3-propylurea?
The IUPAC name of 1-(N'-ethylcarbamimidoyl)-3-propylurea (CID 164628516) is 1-(N'-ethylcarbamimidoyl)-3-propylurea.
What is the SMILES notation for 1-(N'-ethylcarbamimidoyl)-3-propylurea?
The canonical SMILES for 1-(N'-ethylcarbamimidoyl)-3-propylurea is CCCNC(=O)N/C(N)=N/CC.
What is the InChIKey of 1-(N'-ethylcarbamimidoyl)-3-propylurea?
The InChIKey is VGZVSWZMWFCBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4O/c1-3-5-10-7(12)11-6(8)9-4-2/h3-5H2,1-2H3,(H4,8,9,10,11,12).
What are the key properties of 1-(N'-ethylcarbamimidoyl)-3-propylurea?
1-(N'-ethylcarbamimidoyl)-3-propylurea has a molecular weight of 172.23 g/mol, XLogP of 0.03, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N'-ethylcarbamimidoyl)-3-propylurea is sourced from PubChem (CID 164628516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).