C15H26N2O4 — CID 164628547
(2R)-2,4-dihydroxy-3,3-dimethyl-N-[(2-pentyl-1,3-oxazol-5-yl)methyl]butanamide (PubChem CID 164628547) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-[(2-pentyl-1,3-oxazol-5-yl)methyl]butanamide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[(2-pentyl-1,3-oxazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 164628547 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[(2-pentyl-1,3-oxazol-5-yl)methyl]butanamide |
| SMILES | CCCCCc1ncc(CNC(=O)[C@H](O)C(C)(C)CO)o1 |
| InChI | InChI=1S/C15H26N2O4/c1-4-5-6-7-12-16-8-11(21-12)9-17-14(20)13(19)15(2,3)10-18/h8,13,18-19H,4-7,9-10H2,1-3H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | BGUFVELZVSGCIV-ZDUSSCGKSA-N |
| XLogP | 1.40 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|