C28H26N6O3 — CID 164628940
N',3-diphenyl-7-(3,4,5-trimethoxyanilino)-1H-pyrazolo[3,4-c]pyridine-5-carboximidamide (PubChem CID 164628940) has the molecular formula C28H26N6O3 and a molecular weight of 494.56 g/mol. Its IUPAC name is N',3-diphenyl-7-(3,4,5-trimethoxyanilino)-1H-pyrazolo[3,4-c]pyridine-5-carboximidamide.
| Compound Name | N',3-diphenyl-7-(3,4,5-trimethoxyanilino)-1H-pyrazolo[3,4-c]pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 164628940 |
| Molecular Formula | C28H26N6O3 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N',3-diphenyl-7-(3,4,5-trimethoxyanilino)-1H-pyrazolo[3,4-c]pyridine-5-carboximidamide |
| SMILES | COc1cc(Nc2nc(/C(N)=N/c3ccccc3)cc3c(-c4ccccc4)n[nH]c23)cc(OC)c1OC |
| InChI | InChI=1S/C28H26N6O3/c1-35-22-14-19(15-23(36-2)26(22)37-3)31-28-25-20(24(33-34-25)17-10-6-4-7-11-17)16-21(32-28)27(29)30-18-12-8-5-9-13-18/h4-16H,1-3H3,(H2,29,30)(H,31,32)(H,33,34) |
| InChIKey | TXRYUPQPWXUTRJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|