C29H38F2N6O4 — CID 164629002
2-[4-[6-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]hexoxy]phenyl]-N-hydroxyacetamide (PubChem CID 164629002) has the molecular formula C29H38F2N6O4 and a molecular weight of 572.66 g/mol. Its IUPAC name is 2-[4-[6-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]hexoxy]phenyl]-N-hydroxyacetamide.
| Compound Name | 2-[4-[6-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]hexoxy]phenyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 164629002 |
| Molecular Formula | C29H38F2N6O4 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 2-[4-[6-[4-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]piperazin-1-yl]hexoxy]phenyl]-N-hydroxyacetamide |
| SMILES | O=C(Cc1ccc(OCCCCCCN2CCN(CC(O)(Cn3cncn3)c3ccc(F)cc3F)CC2)cc1)NO |
| InChI | InChI=1S/C29H38F2N6O4/c30-24-7-10-26(27(31)18-24)29(39,20-37-22-32-21-33-37)19-36-14-12-35(13-15-36)11-3-1-2-4-16-41-25-8-5-23(6-9-25)17-28(38)34-40/h5-10,18,21-22,39-40H,1-4,11-17,19-20H2,(H,34,38) |
| InChIKey | KGLMFVUCUXHHLH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|