C29H31F3N4O — CID 164629075
N-(3-pyrrolidin-1-ylpropyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide (PubChem CID 164629075) has the molecular formula C29H31F3N4O and a molecular weight of 508.59 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylpropyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | N-(3-pyrrolidin-1-ylpropyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 164629075 |
| Molecular Formula | C29H31F3N4O |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-(3-pyrrolidin-1-ylpropyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]-2,3-dihydroindole-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)c1cccc2c1CCN2c1cc(Cc2cccc(C(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C29H31F3N4O/c30-29(31,32)23-7-3-6-21(19-23)18-22-10-13-33-27(20-22)36-17-11-24-25(8-4-9-26(24)36)28(37)34-12-5-16-35-14-1-2-15-35/h3-4,6-10,13,19-20H,1-2,5,11-12,14-18H2,(H,34,37) |
| InChIKey | QXQPBOWAKDEJBR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|